C38H44N4O6 — CID 10484410
3-O-(1-benzhydrylpiperidin-3-yl) 5-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10484410) has the molecular formula C38H44N4O6 and a molecular weight of 652.79 g/mol. Its IUPAC name is 3-O-(1-benzhydrylpiperidin-3-yl) 5-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(1-benzhydrylpiperidin-3-yl) 5-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10484410 |
| Molecular Formula | C38H44N4O6 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | 3-O-(1-benzhydrylpiperidin-3-yl) 5-O-hexyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCCCCOC(=O)C1=C(C)NC(N)=C(C(=O)OC2CCCN(C(c3ccccc3)c3ccccc3)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H44N4O6/c1-3-4-5-12-23-47-37(43)32-26(2)40-36(39)34(33(32)29-19-13-20-30(24-29)42(45)46)38(44)48-31-21-14-22-41(25-31)35(27-15-8-6-9-16-27)28-17-10-7-11-18-28/h6-11,13,15-20,24,31,33,35,40H,3-5,12,14,21-23,25,39H2,1-2H3 |
| InChIKey | PFNNSQCFGVDTOT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|