C27H32N4O6S — CID 10347255
5-O-propan-2-yl 3-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10347255) has the molecular formula C27H32N4O6S and a molecular weight of 540.64 g/mol. Its IUPAC name is 5-O-propan-2-yl 3-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-propan-2-yl 3-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10347255 |
| Molecular Formula | C27H32N4O6S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 5-O-propan-2-yl 3-O-[1-(thiophen-2-ylmethyl)piperidin-3-yl] 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC2CCCN(Cc3cccs3)C2)=C(N)N1 |
| InChI | InChI=1S/C27H32N4O6S/c1-16(2)36-26(32)22-17(3)29-25(28)24(23(22)18-7-4-8-19(13-18)31(34)35)27(33)37-20-9-5-11-30(14-20)15-21-10-6-12-38-21/h4,6-8,10,12-13,16,20,23,29H,5,9,11,14-15,28H2,1-3H3 |
| InChIKey | XZZOCAMHVQMMGX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|