C27H33N3O6 — CID 126843085
(2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid (PubChem CID 126843085) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is (2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | (2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 126843085 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]-2,5,6-trimethyl-4-(3-nitrophenyl)piperidine-3,5-dicarboxylic acid |
| SMILES | CC1N[C@@H](C)C(C(=O)O)([C@@H]2CCN(Cc3ccccc3)C2)C(c2cccc([N+](=O)[O-])c2)C1(C)C(=O)O |
| InChI | InChI=1S/C27H33N3O6/c1-17-26(3,24(31)32)23(20-10-7-11-22(14-20)30(35)36)27(25(33)34,18(2)28-17)21-12-13-29(16-21)15-19-8-5-4-6-9-19/h4-11,14,17-18,21,23,28H,12-13,15-16H2,1-3H3,(H,31,32)(H,33,34)/t17?,18-,21+,23?,26?,27?/m0/s1 |
| InChIKey | VXTLDADFBDMCMQ-AKOZNSQKSA-N |
| XLogP | 3.74 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|