C19H24N2O8 — CID 57214047
3,5-diethyl-6-methyl-4-(3-nitrophenyl)piperidine-2,3,5-tricarboxylic acid (PubChem CID 57214047) has the molecular formula C19H24N2O8 and a molecular weight of 408.41 g/mol. Its IUPAC name is 3,5-diethyl-6-methyl-4-(3-nitrophenyl)piperidine-2,3,5-tricarboxylic acid.
| Compound Name | 3,5-diethyl-6-methyl-4-(3-nitrophenyl)piperidine-2,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 57214047 |
| Molecular Formula | C19H24N2O8 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 3,5-diethyl-6-methyl-4-(3-nitrophenyl)piperidine-2,3,5-tricarboxylic acid |
| SMILES | CCC1(C(=O)O)C(C)NC(C(=O)O)C(CC)(C(=O)O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H24N2O8/c1-4-18(16(24)25)10(3)20-14(15(22)23)19(5-2,17(26)27)13(18)11-7-6-8-12(9-11)21(28)29/h6-10,13-14,20H,4-5H2,1-3H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | RLMDJAISMYJTHW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 167.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|