C18H25NO4 — CID 57262586
3-ethyl-2,5,6-trimethyl-4-phenylpiperidine-3,5-dicarboxylic acid (PubChem CID 57262586) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-ethyl-2,5,6-trimethyl-4-phenylpiperidine-3,5-dicarboxylic acid.
| Compound Name | 3-ethyl-2,5,6-trimethyl-4-phenylpiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57262586 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-ethyl-2,5,6-trimethyl-4-phenylpiperidine-3,5-dicarboxylic acid |
| SMILES | CCC1(C(=O)O)C(C)NC(C)C(C)(C(=O)O)C1c1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-5-18(16(22)23)12(3)19-11(2)17(4,15(20)21)14(18)13-9-7-6-8-10-13/h6-12,14,19H,5H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | KUFKGYDGGQMFLM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |