C19H23BrN2O6 — CID 57288325
3-(3-bromobutyl)-2,6-dimethyl-4-(3-nitrophenyl)-4,5-dihydro-2H-pyridine-3,5-dicarboxylic acid (PubChem CID 57288325) has the molecular formula C19H23BrN2O6 and a molecular weight of 455.31 g/mol. Its IUPAC name is 3-(3-bromobutyl)-2,6-dimethyl-4-(3-nitrophenyl)-4,5-dihydro-2H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 3-(3-bromobutyl)-2,6-dimethyl-4-(3-nitrophenyl)-4,5-dihydro-2H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57288325 |
| Molecular Formula | C19H23BrN2O6 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 3-(3-bromobutyl)-2,6-dimethyl-4-(3-nitrophenyl)-4,5-dihydro-2H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C)C(CCC(C)Br)(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C1C(=O)O |
| InChI | InChI=1S/C19H23BrN2O6/c1-10(20)7-8-19(18(25)26)12(3)21-11(2)15(17(23)24)16(19)13-5-4-6-14(9-13)22(27)28/h4-6,9-10,12,15-16H,7-8H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | PPYWYEDUMNJBFE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|