C20H25BrN2O6 — CID 69372812
2-(1-bromo-2-methylpropyl)-1-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid (PubChem CID 69372812) has the molecular formula C20H25BrN2O6 and a molecular weight of 469.33 g/mol. Its IUPAC name is 2-(1-bromo-2-methylpropyl)-1-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 2-(1-bromo-2-methylpropyl)-1-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 69372812 |
| Molecular Formula | C20H25BrN2O6 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-(1-bromo-2-methylpropyl)-1-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3-carboxylic acid |
| SMILES | COC(=O)N1C(C)=CC(c2cccc([N+](=O)[O-])c2)C(C(=O)O)C1(C)C(Br)C(C)C |
| InChI | InChI=1S/C20H25BrN2O6/c1-11(2)17(21)20(4)16(18(24)25)15(9-12(3)22(20)19(26)29-5)13-7-6-8-14(10-13)23(27)28/h6-11,15-17H,1-5H3,(H,24,25) |
| InChIKey | SPBGJUGNIBTLMS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|