C21H18N6O4S2 — CID 72697999
2,6-dimethyl-4-(4-nitrophenyl)-3-N,5-N-bis(1,3-thiazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 72697999) has the molecular formula C21H18N6O4S2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-nitrophenyl)-3-N,5-N-bis(1,3-thiazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 2,6-dimethyl-4-(4-nitrophenyl)-3-N,5-N-bis(1,3-thiazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 72697999 |
| Molecular Formula | C21H18N6O4S2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2,6-dimethyl-4-(4-nitrophenyl)-3-N,5-N-bis(1,3-thiazol-2-yl)-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CC1=C(C(=O)Nc2nccs2)C(c2ccc([N+](=O)[O-])cc2)C(C(=O)Nc2nccs2)=C(C)N1 |
| InChI | InChI=1S/C21H18N6O4S2/c1-11-15(18(28)25-20-22-7-9-32-20)17(13-3-5-14(6-4-13)27(30)31)16(12(2)24-11)19(29)26-21-23-8-10-33-21/h3-10,17,24H,1-2H3,(H,22,25,28)(H,23,26,29) |
| InChIKey | GUCZBIRDNYVRJZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|