C17H18N2O5 — CID 10640153
methyl 5-acetyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 10640153) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl 5-acetyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-acetyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10640153 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl 5-acetyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(C)=O)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N2O5/c1-9-14(11(3)20)16(15(10(2)18-9)17(21)24-4)12-5-7-13(8-6-12)19(22)23/h5-8,16,18H,1-4H3 |
| InChIKey | ITJQRIMCMAYJEL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|