C11H10ClN3O3S — CID 174506576
2-chloro-N-(1,3-thiazol-2-yl)acetamide;nitrobenzene (PubChem CID 174506576) has the molecular formula C11H10ClN3O3S and a molecular weight of 299.74 g/mol. Its IUPAC name is 2-chloro-N-(1,3-thiazol-2-yl)acetamide;nitrobenzene.
| Compound Name | 2-chloro-N-(1,3-thiazol-2-yl)acetamide;nitrobenzene |
|---|---|
| PubChem CID | 174506576 |
| Molecular Formula | C11H10ClN3O3S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-chloro-N-(1,3-thiazol-2-yl)acetamide;nitrobenzene |
| SMILES | O=C(CCl)Nc1nccs1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C5H5ClN2OS/c8-7(9)6-4-2-1-3-5-6;6-3-4(9)8-5-7-1-2-10-5/h1-5H;1-2H,3H2,(H,7,8,9) |
| InChIKey | BDDDJQRGCZNERP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|