C22H17N5O6 — CID 135398435
methyl 3,3-dicyano-6-methyl-2,4-bis(4-nitrophenyl)-2,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 135398435) has the molecular formula C22H17N5O6 and a molecular weight of 447.41 g/mol. Its IUPAC name is methyl 3,3-dicyano-6-methyl-2,4-bis(4-nitrophenyl)-2,4-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | methyl 3,3-dicyano-6-methyl-2,4-bis(4-nitrophenyl)-2,4-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 135398435 |
| Molecular Formula | C22H17N5O6 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | methyl 3,3-dicyano-6-methyl-2,4-bis(4-nitrophenyl)-2,4-dihydro-1H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(c2ccc([N+](=O)[O-])cc2)C(C#N)(C#N)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H17N5O6/c1-13-18(21(28)33-2)19(14-3-7-16(8-4-14)26(29)30)22(11-23,12-24)20(25-13)15-5-9-17(10-6-15)27(31)32/h3-10,19-20,25H,1-2H3 |
| InChIKey | ZGRPGKRQDOGKQR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 172.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|