C20H23N3O6 — CID 14154002
5-O-methyl 3-O-(2-methylpropyl) 3-cyano-6-methyl-4-(3-nitrophenyl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 14154002) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is 5-O-methyl 3-O-(2-methylpropyl) 3-cyano-6-methyl-4-(3-nitrophenyl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-methyl 3-O-(2-methylpropyl) 3-cyano-6-methyl-4-(3-nitrophenyl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14154002 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 5-O-methyl 3-O-(2-methylpropyl) 3-cyano-6-methyl-4-(3-nitrophenyl)-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NCC(C#N)(C(=O)OCC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23N3O6/c1-12(2)9-29-19(25)20(10-21)11-22-13(3)16(18(24)28-4)17(20)14-6-5-7-15(8-14)23(26)27/h5-8,12,17,22H,9,11H2,1-4H3 |
| InChIKey | UBEJQOXTCFCFDW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|