C20H17N5O7 — CID 101114541
5-O-[(4-cyano-1,2,5-oxadiazol-3-yl)methyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 101114541) has the molecular formula C20H17N5O7 and a molecular weight of 439.38 g/mol. Its IUPAC name is 5-O-[(4-cyano-1,2,5-oxadiazol-3-yl)methyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[(4-cyano-1,2,5-oxadiazol-3-yl)methyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 101114541 |
| Molecular Formula | C20H17N5O7 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 5-O-[(4-cyano-1,2,5-oxadiazol-3-yl)methyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCc2nonc2C#N)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N5O7/c1-10-16(19(26)30-3)18(12-5-4-6-13(7-12)25(28)29)17(11(2)22-10)20(27)31-9-15-14(8-21)23-32-24-15/h4-7,18,22H,9H2,1-3H3 |
| InChIKey | SZASJMXIZWSJNO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 170.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|