C27H25N3O6 — CID 6447855
5-O-[(E)-4-(4-cyanophenyl)but-3-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 6447855) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is 5-O-[(E)-4-(4-cyanophenyl)but-3-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[(E)-4-(4-cyanophenyl)but-3-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 6447855 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 5-O-[(E)-4-(4-cyanophenyl)but-3-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC/C=C/c2ccc(C#N)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H25N3O6/c1-17-23(26(31)35-3)25(21-8-6-9-22(15-21)30(33)34)24(18(2)29-17)27(32)36-14-5-4-7-19-10-12-20(16-28)13-11-19/h4,6-13,15,25,29H,5,14H2,1-3H3/b7-4+ |
| InChIKey | ANWXNFYCBBCFJX-QPJJXVBHSA-N |
| XLogP | 4.52 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|