C15H10N4O4 — CID 5255000
ethyl 1,2,2-tricyano-3-(4-nitrophenyl)cyclopropane-1-carboxylate (PubChem CID 5255000) has the molecular formula C15H10N4O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is ethyl 1,2,2-tricyano-3-(4-nitrophenyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 1,2,2-tricyano-3-(4-nitrophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 5255000 |
| Molecular Formula | C15H10N4O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | ethyl 1,2,2-tricyano-3-(4-nitrophenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C#N)C(c2ccc([N+](=O)[O-])cc2)C1(C#N)C#N |
| InChI | InChI=1S/C15H10N4O4/c1-2-23-13(20)15(9-18)12(14(15,7-16)8-17)10-3-5-11(6-4-10)19(21)22/h3-6,12H,2H2,1H3 |
| InChIKey | DXPAEMYJKRIALS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 140.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|