C20H23NO6 — CID 132607564
trans-triethyl (2S,3S)-2-cyano-3-(4-methylphenyl)cyclopropane-1,1,2-tricarboxylate (PubChem CID 132607564) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is trans-triethyl (2S,3S)-2-cyano-3-(4-methylphenyl)cyclopropane-1,1,2-tricarboxylate.
| Compound Name | trans-triethyl (2S,3S)-2-cyano-3-(4-methylphenyl)cyclopropane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 132607564 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | trans-triethyl (2S,3S)-2-cyano-3-(4-methylphenyl)cyclopropane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2ccc(C)cc2)[C@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C20H23NO6/c1-5-25-16(22)19(12-21)15(14-10-8-13(4)9-11-14)20(19,17(23)26-6-2)18(24)27-7-3/h8-11,15H,5-7H2,1-4H3/t15-,19+/m0/s1 |
| InChIKey | VDJFBSXTECXJKW-HNAYVOBHSA-N |
| XLogP | 2.28 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|