C25H23NO4 — CID 132581047
ethyl 1-cyano-2-(7,8-dimethyl-2-oxochromen-4-yl)-3-(4-methylphenyl)cyclopropane-1-carboxylate (PubChem CID 132581047) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl 1-cyano-2-(7,8-dimethyl-2-oxochromen-4-yl)-3-(4-methylphenyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-cyano-2-(7,8-dimethyl-2-oxochromen-4-yl)-3-(4-methylphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 132581047 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl 1-cyano-2-(7,8-dimethyl-2-oxochromen-4-yl)-3-(4-methylphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C#N)C(c2ccc(C)cc2)C1c1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C25H23NO4/c1-5-29-24(28)25(13-26)21(17-9-6-14(2)7-10-17)22(25)19-12-20(27)30-23-16(4)15(3)8-11-18(19)23/h6-12,21-22H,5H2,1-4H3 |
| InChIKey | FDCSSYZSNADPCH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 80.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|