C22H17Cl2N3O3 — CID 24798988
ethyl (2R,3S,4S,5S)-2,4-bis(4-chlorophenyl)-3,5-dicyano-6-oxopiperidine-3-carboxylate (PubChem CID 24798988) has the molecular formula C22H17Cl2N3O3 and a molecular weight of 442.30 g/mol. Its IUPAC name is ethyl (2R,3S,4S,5S)-2,4-bis(4-chlorophenyl)-3,5-dicyano-6-oxopiperidine-3-carboxylate.
| Compound Name | ethyl (2R,3S,4S,5S)-2,4-bis(4-chlorophenyl)-3,5-dicyano-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 24798988 |
| Molecular Formula | C22H17Cl2N3O3 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | ethyl (2R,3S,4S,5S)-2,4-bis(4-chlorophenyl)-3,5-dicyano-6-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)[C@@H](c2ccc(Cl)cc2)NC(=O)[C@H](C#N)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17Cl2N3O3/c1-2-30-21(29)22(12-26)18(13-3-7-15(23)8-4-13)17(11-25)20(28)27-19(22)14-5-9-16(24)10-6-14/h3-10,17-19H,2H2,1H3,(H,27,28)/t17-,18-,19-,22+/m1/s1 |
| InChIKey | UHGJIMXCOJXDJJ-YXTQBTIXSA-N |
| XLogP | 4.16 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |