C22H18Cl2N2O5 — CID 139267485
dimethyl 2,4-bis(4-chlorophenyl)-3-cyano-6-oxopiperidine-3,5-dicarboxylate (PubChem CID 139267485) has the molecular formula C22H18Cl2N2O5 and a molecular weight of 461.30 g/mol. Its IUPAC name is dimethyl 2,4-bis(4-chlorophenyl)-3-cyano-6-oxopiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,4-bis(4-chlorophenyl)-3-cyano-6-oxopiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139267485 |
| Molecular Formula | C22H18Cl2N2O5 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | dimethyl 2,4-bis(4-chlorophenyl)-3-cyano-6-oxopiperidine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(=O)NC(c2ccc(Cl)cc2)C(C#N)(C(=O)OC)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O5/c1-30-20(28)16-17(12-3-7-14(23)8-4-12)22(11-25,21(29)31-2)18(26-19(16)27)13-5-9-15(24)10-6-13/h3-10,16-18H,1-2H3,(H,26,27) |
| InChIKey | OMUKUZZGEILUKA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|