C26H21ClN2O2 — CID 138979250
methyl (1S,2S,4S,5R,6S)-4-(4-chlorophenyl)-6-cyano-1,5-diphenyl-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 138979250) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is methyl (1S,2S,4S,5R,6S)-4-(4-chlorophenyl)-6-cyano-1,5-diphenyl-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1S,2S,4S,5R,6S)-4-(4-chlorophenyl)-6-cyano-1,5-diphenyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 138979250 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | methyl (1S,2S,4S,5R,6S)-4-(4-chlorophenyl)-6-cyano-1,5-diphenyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccc(Cl)cc2)[C@@]2(c3ccccc3)[C@H](C#N)[C@@]12c1ccccc1 |
| InChI | InChI=1S/C26H21ClN2O2/c1-31-24(30)23-26(19-10-6-3-7-11-19)21(16-28)25(26,18-8-4-2-5-9-18)22(29-23)17-12-14-20(27)15-13-17/h2-15,21-23,29H,1H3/t21-,22-,23+,25+,26-/m0/s1 |
| InChIKey | GOGNUOMRCOSGPS-RKCYMAHVSA-N |
| XLogP | 4.56 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |