C19H18O4 — CID 882276
trans-dimethyl (1R,2R)-3,3-diphenylcyclopropane-1,2-dicarboxylate (PubChem CID 882276) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is trans-dimethyl (1R,2R)-3,3-diphenylcyclopropane-1,2-dicarboxylate.
| Compound Name | trans-dimethyl (1R,2R)-3,3-diphenylcyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 882276 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | trans-dimethyl (1R,2R)-3,3-diphenylcyclopropane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O4/c1-22-17(20)15-16(18(21)23-2)19(15,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | ZMTMDYJPIDDFHD-HOTGVXAUSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |