C23H24O10 — CID 10647641
tetramethyl 3a-methyl-2,5-dioxo-6a-phenyl-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 10647641) has the molecular formula C23H24O10 and a molecular weight of 460.44 g/mol. Its IUPAC name is tetramethyl 3a-methyl-2,5-dioxo-6a-phenyl-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetramethyl 3a-methyl-2,5-dioxo-6a-phenyl-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 10647641 |
| Molecular Formula | C23H24O10 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | tetramethyl 3a-methyl-2,5-dioxo-6a-phenyl-1,3,4,6-tetrahydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)C2(c3ccccc3)C(C(=O)OC)C(=O)C(C(=O)OC)C12C |
| InChI | InChI=1S/C23H24O10/c1-22-12(18(26)30-2)16(24)14(20(28)32-4)23(22,11-9-7-6-8-10-11)15(21(29)33-5)17(25)13(22)19(27)31-3/h6-10,12-15H,1-5H3 |
| InChIKey | JIDVGBLROWTAEY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|