C22H20NO7- — CID 163132181
dimethyl (1S,8S,9S,11R)-12-[hydroxy(oxido)amino]-10-oxo-12-phenyltricyclo[6.3.1.02,7]dodeca-2,4,6-triene-9,11-dicarboxylate (PubChem CID 163132181) has the molecular formula C22H20NO7- and a molecular weight of 410.40 g/mol. Its IUPAC name is dimethyl (1S,8S,9S,11R)-12-[hydroxy(oxido)amino]-10-oxo-12-phenyltricyclo[6.3.1.02,7]dodeca-2,4,6-triene-9,11-dicarboxylate.
| Compound Name | dimethyl (1S,8S,9S,11R)-12-[hydroxy(oxido)amino]-10-oxo-12-phenyltricyclo[6.3.1.02,7]dodeca-2,4,6-triene-9,11-dicarboxylate |
|---|---|
| PubChem CID | 163132181 |
| Molecular Formula | C22H20NO7- |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | dimethyl (1S,8S,9S,11R)-12-[hydroxy(oxido)amino]-10-oxo-12-phenyltricyclo[6.3.1.02,7]dodeca-2,4,6-triene-9,11-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)[C@H](C(=O)OC)[C@H]2c3ccccc3[C@H]1C2(c1ccccc1)N([O-])O |
| InChI | InChI=1S/C22H20NO7/c1-29-20(25)15-17-13-10-6-7-11-14(13)18(16(19(15)24)21(26)30-2)22(17,23(27)28)12-8-4-3-5-9-12/h3-11,15-18,27H,1-2H3/q-1/t15-,16+,17-,18-,22?/m1/s1 |
| InChIKey | KECRXVATDXJRHB-YULKMRLRSA-N |
| XLogP | 2.11 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|