C22H20O4 — CID 10665399
dimethyl (1S,2R)-3,6-diphenylcyclohexa-3,5-diene-1,2-dicarboxylate (PubChem CID 10665399) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is dimethyl (1S,2R)-3,6-diphenylcyclohexa-3,5-diene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2R)-3,6-diphenylcyclohexa-3,5-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10665399 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | dimethyl (1S,2R)-3,6-diphenylcyclohexa-3,5-diene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(c2ccccc2)=CC=C(c2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H20O4/c1-25-21(23)19-17(15-9-5-3-6-10-15)13-14-18(20(19)22(24)26-2)16-11-7-4-8-12-16/h3-14,19-20H,1-2H3/t19-,20+ |
| InChIKey | IZJKURQANMAIBN-BGYRXZFFSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |