C16H18O4 — CID 167304350
dimethyl 4-methyl-3-phenylcyclopent-2-ene-1,1-dicarboxylate (PubChem CID 167304350) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is dimethyl 4-methyl-3-phenylcyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 4-methyl-3-phenylcyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 167304350 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | dimethyl 4-methyl-3-phenylcyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C16H18O4/c1-11-9-16(14(17)19-2,15(18)20-3)10-13(11)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | FJSXLNLFHMHHAP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|