C24H24O6Se — CID 178069834
dimethyl 3-(4-methoxycarbonylphenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 178069834) has the molecular formula C24H24O6Se and a molecular weight of 487.41 g/mol. Its IUPAC name is dimethyl 3-(4-methoxycarbonylphenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(4-methoxycarbonylphenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 178069834 |
| Molecular Formula | C24H24O6Se |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | dimethyl 3-(4-methoxycarbonylphenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)c1ccc(C2=CC(C(=O)OC)(C(=O)OC)CC2C[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O6Se/c1-28-21(25)17-11-9-16(10-12-17)20-14-24(22(26)29-2,23(27)30-3)13-18(20)15-31-19-7-5-4-6-8-19/h4-12,14,18H,13,15H2,1-3H3 |
| InChIKey | SFYVYVAXNKNKGO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|