C18H22O5Se — CID 178069832
dimethyl 3-(4-methoxyphenyl)-4-(methylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 178069832) has the molecular formula C18H22O5Se and a molecular weight of 397.33 g/mol. Its IUPAC name is dimethyl 3-(4-methoxyphenyl)-4-(methylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(4-methoxyphenyl)-4-(methylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 178069832 |
| Molecular Formula | C18H22O5Se |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | dimethyl 3-(4-methoxyphenyl)-4-(methylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(c2ccc(OC)cc2)C(C[Se]C)C1 |
| InChI | InChI=1S/C18H22O5Se/c1-21-14-7-5-12(6-8-14)15-10-18(16(19)22-2,17(20)23-3)9-13(15)11-24-4/h5-8,10,13H,9,11H2,1-4H3 |
| InChIKey | ODBAOOOBXDGDRD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|