C23H21F3O4Se — CID 178069840
dimethyl 4-(phenylselanylmethyl)-3-[4-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 178069840) has the molecular formula C23H21F3O4Se and a molecular weight of 497.37 g/mol. Its IUPAC name is dimethyl 4-(phenylselanylmethyl)-3-[4-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 4-(phenylselanylmethyl)-3-[4-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 178069840 |
| Molecular Formula | C23H21F3O4Se |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | dimethyl 4-(phenylselanylmethyl)-3-[4-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(c2ccc(C(F)(F)F)cc2)C(C[Se]c2ccccc2)C1 |
| InChI | InChI=1S/C23H21F3O4Se/c1-29-20(27)22(21(28)30-2)12-16(14-31-18-6-4-3-5-7-18)19(13-22)15-8-10-17(11-9-15)23(24,25)26/h3-11,13,16H,12,14H2,1-2H3 |
| InChIKey | ATDMRTVGVLSQFB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|