C22H23NO4Se — CID 162349660
dimethyl 3-(3-aminophenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 162349660) has the molecular formula C22H23NO4Se and a molecular weight of 444.39 g/mol. Its IUPAC name is dimethyl 3-(3-aminophenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(3-aminophenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162349660 |
| Molecular Formula | C22H23NO4Se |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | dimethyl 3-(3-aminophenyl)-4-(phenylselanylmethyl)cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(c2cccc(N)c2)C(C[Se]c2ccccc2)C1 |
| InChI | InChI=1S/C22H23NO4Se/c1-26-20(24)22(21(25)27-2)12-16(14-28-18-9-4-3-5-10-18)19(13-22)15-7-6-8-17(23)11-15/h3-11,13,16H,12,14,23H2,1-2H3 |
| InChIKey | DTGYREKPALKOAU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|