C18H17NO3Se — CID 11199655
methyl (4S,5R)-2-phenyl-5-(phenylselanylmethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 11199655) has the molecular formula C18H17NO3Se and a molecular weight of 374.30 g/mol. Its IUPAC name is methyl (4S,5R)-2-phenyl-5-(phenylselanylmethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5R)-2-phenyl-5-(phenylselanylmethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11199655 |
| Molecular Formula | C18H17NO3Se |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | methyl (4S,5R)-2-phenyl-5-(phenylselanylmethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@H]1N=C(c2ccccc2)O[C@H]1C[Se]c1ccccc1 |
| InChI | InChI=1S/C18H17NO3Se/c1-21-18(20)16-15(12-23-14-10-6-3-7-11-14)22-17(19-16)13-8-4-2-5-9-13/h2-11,15-16H,12H2,1H3/t15-,16-/m0/s1 |
| InChIKey | GCWYIPDMQSGNMH-HOTGVXAUSA-N |
| XLogP | 1.82 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|