C21H23NO4 — CID 11142748
methyl (4S,5S)-2-phenyl-5-(3-phenylmethoxypropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 11142748) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl (4S,5S)-2-phenyl-5-(3-phenylmethoxypropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5S)-2-phenyl-5-(3-phenylmethoxypropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11142748 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl (4S,5S)-2-phenyl-5-(3-phenylmethoxypropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@H]1N=C(c2ccccc2)O[C@H]1CCCOCc1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-24-21(23)19-18(26-20(22-19)17-11-6-3-7-12-17)13-8-14-25-15-16-9-4-2-5-10-16/h2-7,9-12,18-19H,8,13-15H2,1H3/t18-,19-/m0/s1 |
| InChIKey | JBQXBDGBVAOVCY-OALUTQOASA-N |
| XLogP | 3.37 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|