C14H18O3 — CID 135054286
1-[(2S,3R)-3-(3-phenylmethoxypropyl)oxiran-2-yl]ethanone (PubChem CID 135054286) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1-[(2S,3R)-3-(3-phenylmethoxypropyl)oxiran-2-yl]ethanone.
| Compound Name | 1-[(2S,3R)-3-(3-phenylmethoxypropyl)oxiran-2-yl]ethanone |
|---|---|
| PubChem CID | 135054286 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-[(2S,3R)-3-(3-phenylmethoxypropyl)oxiran-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1O[C@@H]1CCCOCc1ccccc1 |
| InChI | InChI=1S/C14H18O3/c1-11(15)14-13(17-14)8-5-9-16-10-12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | JJOWYXRCELNYMN-ZIAGYGMSSA-N |
| XLogP | 2.34 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|