C16H21IO3 — CID 15737546
(2R,3S)-2-(1-iodoethenyl)-3-[4-(phenylmethoxymethoxy)butyl]oxirane (PubChem CID 15737546) has the molecular formula C16H21IO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is (2R,3S)-2-(1-iodoethenyl)-3-[4-(phenylmethoxymethoxy)butyl]oxirane.
| Compound Name | (2R,3S)-2-(1-iodoethenyl)-3-[4-(phenylmethoxymethoxy)butyl]oxirane |
|---|---|
| PubChem CID | 15737546 |
| Molecular Formula | C16H21IO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (2R,3S)-2-(1-iodoethenyl)-3-[4-(phenylmethoxymethoxy)butyl]oxirane |
| SMILES | C=C(I)[C@@H]1O[C@H]1CCCCOCOCc1ccccc1 |
| InChI | InChI=1S/C16H21IO3/c1-13(17)16-15(20-16)9-5-6-10-18-12-19-11-14-7-3-2-4-8-14/h2-4,7-8,15-16H,1,5-6,9-12H2/t15-,16-/m0/s1 |
| InChIKey | HEFNWRVUMCXTRY-HOTGVXAUSA-N |
| XLogP | 4.06 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|