C20H32O3 — CID 101462232
(2S,3S)-5-ethoxy-3-methyl-2-(6-phenylmethoxyhexyl)oxolane (PubChem CID 101462232) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2S,3S)-5-ethoxy-3-methyl-2-(6-phenylmethoxyhexyl)oxolane.
| Compound Name | (2S,3S)-5-ethoxy-3-methyl-2-(6-phenylmethoxyhexyl)oxolane |
|---|---|
| PubChem CID | 101462232 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2S,3S)-5-ethoxy-3-methyl-2-(6-phenylmethoxyhexyl)oxolane |
| SMILES | CCOC1C[C@H](C)[C@H](CCCCCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C20H32O3/c1-3-22-20-15-17(2)19(23-20)13-9-4-5-10-14-21-16-18-11-7-6-8-12-18/h6-8,11-12,17,19-20H,3-5,9-10,13-16H2,1-2H3/t17-,19-,20?/m0/s1 |
| InChIKey | XPARJVQTSSFIAB-CTCAENTCSA-N |
| XLogP | 4.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|