C12H14O3 — CID 131847944
(2S,3R)-3-(2-phenylmethoxyethyl)oxirane-2-carbaldehyde (PubChem CID 131847944) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S,3R)-3-(2-phenylmethoxyethyl)oxirane-2-carbaldehyde.
| Compound Name | (2S,3R)-3-(2-phenylmethoxyethyl)oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 131847944 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2S,3R)-3-(2-phenylmethoxyethyl)oxirane-2-carbaldehyde |
| SMILES | O=C[C@H]1O[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C12H14O3/c13-8-12-11(15-12)6-7-14-9-10-4-2-1-3-5-10/h1-5,8,11-12H,6-7,9H2/t11-,12-/m1/s1 |
| InChIKey | GLVYRGBFBFOBQS-VXGBXAGGSA-N |
| XLogP | 1.56 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|