C23H32O3 — CID 10904399
(2S,3R)-3-[(E,2R,7S)-2,6,7-trimethyl-4-methylidene-9-phenylmethoxynon-5-enyl]oxirane-2-carbaldehyde (PubChem CID 10904399) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (2S,3R)-3-[(E,2R,7S)-2,6,7-trimethyl-4-methylidene-9-phenylmethoxynon-5-enyl]oxirane-2-carbaldehyde.
| Compound Name | (2S,3R)-3-[(E,2R,7S)-2,6,7-trimethyl-4-methylidene-9-phenylmethoxynon-5-enyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 10904399 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (2S,3R)-3-[(E,2R,7S)-2,6,7-trimethyl-4-methylidene-9-phenylmethoxynon-5-enyl]oxirane-2-carbaldehyde |
| SMILES | C=C(/C=C(\C)[C@@H](C)CCOCc1ccccc1)C[C@@H](C)C[C@H]1O[C@@H]1C=O |
| InChI | InChI=1S/C23H32O3/c1-17(12-18(2)14-22-23(15-24)26-22)13-20(4)19(3)10-11-25-16-21-8-6-5-7-9-21/h5-9,13,15,18-19,22-23H,1,10-12,14,16H2,2-4H3/b20-13+/t18-,19+,22-,23-/m1/s1 |
| InChIKey | YJIMUAHTBNXBPT-NJWMSACHSA-N |
| XLogP | 5.11 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|