C24H30O3 — CID 71733048
(2S,3S)-2-methyl-1-[(2S,3S)-3-[(E)-2-phenylethenyl]oxiran-2-yl]-6-phenylmethoxyhexan-3-ol (PubChem CID 71733048) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (2S,3S)-2-methyl-1-[(2S,3S)-3-[(E)-2-phenylethenyl]oxiran-2-yl]-6-phenylmethoxyhexan-3-ol.
| Compound Name | (2S,3S)-2-methyl-1-[(2S,3S)-3-[(E)-2-phenylethenyl]oxiran-2-yl]-6-phenylmethoxyhexan-3-ol |
|---|---|
| PubChem CID | 71733048 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (2S,3S)-2-methyl-1-[(2S,3S)-3-[(E)-2-phenylethenyl]oxiran-2-yl]-6-phenylmethoxyhexan-3-ol |
| SMILES | C[C@@H](C[C@@H]1O[C@H]1/C=C/c1ccccc1)[C@@H](O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C24H30O3/c1-19(17-24-23(27-24)15-14-20-9-4-2-5-10-20)22(25)13-8-16-26-18-21-11-6-3-7-12-21/h2-7,9-12,14-15,19,22-25H,8,13,16-18H2,1H3/b15-14+/t19-,22-,23-,24-/m0/s1 |
| InChIKey | ZXWZATIMFDMUFD-OMGXGVIMSA-N |
| XLogP | 4.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|