C20H30O4 — CID 101401637
(E,2R)-7-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]hept-6-en-2-ol (PubChem CID 101401637) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (E,2R)-7-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]hept-6-en-2-ol.
| Compound Name | (E,2R)-7-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 101401637 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (E,2R)-7-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]hept-6-en-2-ol |
| SMILES | C[C@@H](O)CCC/C=C/[C@@H]1OC(C)(C)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C20H30O4/c1-16(21)10-6-4-9-13-18-19(24-20(2,3)23-18)15-22-14-17-11-7-5-8-12-17/h5,7-9,11-13,16,18-19,21H,4,6,10,14-15H2,1-3H3/b13-9+/t16-,18+,19+/m1/s1 |
| InChIKey | KLOWRNABCNNSNP-GBONPQLBSA-N |
| XLogP | 3.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|