C24H32O4 — CID 56971424
(2R)-11-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]undeca-8,10-diyn-2-ol (PubChem CID 56971424) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2R)-11-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]undeca-8,10-diyn-2-ol.
| Compound Name | (2R)-11-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]undeca-8,10-diyn-2-ol |
|---|---|
| PubChem CID | 56971424 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2R)-11-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]undeca-8,10-diyn-2-ol |
| SMILES | C[C@@H](O)CCCCCC#CC#C[C@@H]1OC(C)(C)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C24H32O4/c1-20(25)14-10-7-5-4-6-8-13-17-22-23(28-24(2,3)27-22)19-26-18-21-15-11-9-12-16-21/h9,11-12,15-16,20,22-23,25H,4-5,7,10,14,18-19H2,1-3H3/t20-,22+,23+/m1/s1 |
| InChIKey | KRQMMMXCBIVRAL-PUHATCMVSA-N |
| XLogP | 4.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|