C20H23ClO3S — CID 135068570
(4R,5S)-4-[chloro(phenylsulfanyl)methyl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane (PubChem CID 135068570) has the molecular formula C20H23ClO3S and a molecular weight of 378.92 g/mol. Its IUPAC name is (4R,5S)-4-[chloro(phenylsulfanyl)methyl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[chloro(phenylsulfanyl)methyl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 135068570 |
| Molecular Formula | C20H23ClO3S |
| Molecular Weight | 378.92 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (4R,5S)-4-[chloro(phenylsulfanyl)methyl]-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H](COCc2ccccc2)[C@H](C(Cl)Sc2ccccc2)O1 |
| InChI | InChI=1S/C20H23ClO3S/c1-20(2)23-17(14-22-13-15-9-5-3-6-10-15)18(24-20)19(21)25-16-11-7-4-8-12-16/h3-12,17-19H,13-14H2,1-2H3/t17-,18+,19?/m0/s1 |
| InChIKey | NPMBOSMSYLEAJH-PAMZHZACSA-N |
| XLogP | 5.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|