C29H32O5S — CID 10005883
(3aS,4R,6S,7R,7aS)-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 10005883) has the molecular formula C29H32O5S and a molecular weight of 492.64 g/mol. Its IUPAC name is (3aS,4R,6S,7R,7aS)-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aS,4R,6S,7R,7aS)-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 10005883 |
| Molecular Formula | C29H32O5S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (3aS,4R,6S,7R,7aS)-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COCc1ccccc1)O[C@@H](Sc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C29H32O5S/c1-29(2)33-25-24(20-30-18-21-12-6-3-7-13-21)32-28(35-23-16-10-5-11-17-23)27(26(25)34-29)31-19-22-14-8-4-9-15-22/h3-17,24-28H,18-20H2,1-2H3/t24-,25+,26+,27-,28+/m1/s1 |
| InChIKey | WSSJTOWJQYTKPS-JYIVOWJTSA-N |
| XLogP | 5.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |