C30H34O5S — CID 10720373
(2S,3S,4aR,5R,7R,8S,8aS)-2,3-dimethyl-8-phenylmethoxy-5-(phenylmethoxymethyl)-7-phenylsulfanyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]dioxine (PubChem CID 10720373) has the molecular formula C30H34O5S and a molecular weight of 506.66 g/mol. Its IUPAC name is (2S,3S,4aR,5R,7R,8S,8aS)-2,3-dimethyl-8-phenylmethoxy-5-(phenylmethoxymethyl)-7-phenylsulfanyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]dioxine.
| Compound Name | (2S,3S,4aR,5R,7R,8S,8aS)-2,3-dimethyl-8-phenylmethoxy-5-(phenylmethoxymethyl)-7-phenylsulfanyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 10720373 |
| Molecular Formula | C30H34O5S |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (2S,3S,4aR,5R,7R,8S,8aS)-2,3-dimethyl-8-phenylmethoxy-5-(phenylmethoxymethyl)-7-phenylsulfanyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]dioxine |
| SMILES | C[C@@H]1O[C@@H]2[C@H](OCc3ccccc3)[C@@H](Sc3ccccc3)O[C@H](COCc3ccccc3)[C@H]2O[C@H]1C |
| InChI | InChI=1S/C30H34O5S/c1-21-22(2)34-28-27(33-21)26(20-31-18-23-12-6-3-7-13-23)35-30(36-25-16-10-5-11-17-25)29(28)32-19-24-14-8-4-9-15-24/h3-17,21-22,26-30H,18-20H2,1-2H3/t21-,22-,26+,27+,28-,29-,30+/m0/s1 |
| InChIKey | JXVHXYFUOKBBCX-XLDOCZATSA-N |
| XLogP | 5.87 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |