C25H32O5S — CID 100977160
(3aS,4R,6S,7R,7aS)-6-ethylsulfanyl-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 100977160) has the molecular formula C25H32O5S and a molecular weight of 444.59 g/mol. Its IUPAC name is (3aS,4R,6S,7R,7aS)-6-ethylsulfanyl-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aS,4R,6S,7R,7aS)-6-ethylsulfanyl-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 100977160 |
| Molecular Formula | C25H32O5S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (3aS,4R,6S,7R,7aS)-6-ethylsulfanyl-2,2-dimethyl-7-phenylmethoxy-4-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CCS[C@@H]1O[C@H](COCc2ccccc2)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H32O5S/c1-4-31-24-23(27-16-19-13-9-6-10-14-19)22-21(29-25(2,3)30-22)20(28-24)17-26-15-18-11-7-5-8-12-18/h5-14,20-24H,4,15-17H2,1-3H3/t20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | KYGMIRFFWBPELR-BAHGYDIPSA-N |
| XLogP | 4.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |