C20H26O4 — CID 101187020
(4S,5S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(1S)-1-prop-2-enoxybut-3-ynyl]-1,3-dioxolane (PubChem CID 101187020) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(1S)-1-prop-2-enoxybut-3-ynyl]-1,3-dioxolane.
| Compound Name | (4S,5S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(1S)-1-prop-2-enoxybut-3-ynyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 101187020 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(1S)-1-prop-2-enoxybut-3-ynyl]-1,3-dioxolane |
| SMILES | C#CC[C@H](OCC=C)[C@@H]1OC(C)(C)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C20H26O4/c1-5-10-17(22-13-6-2)19-18(23-20(3,4)24-19)15-21-14-16-11-8-7-9-12-16/h1,6-9,11-12,17-19H,2,10,13-15H2,3-4H3/t17-,18-,19-/m0/s1 |
| InChIKey | HCXQGUHJRYMMIT-FHWLQOOXSA-N |
| XLogP | 3.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|