C17H22O4 — CID 10946196
(1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]but-3-yn-1-ol (PubChem CID 10946196) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]but-3-yn-1-ol.
| Compound Name | (1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 10946196 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]but-3-yn-1-ol |
| SMILES | C#CC[C@H](O)[C@@H]1OC(C)(C)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C17H22O4/c1-4-8-14(18)16-15(20-17(2,3)21-16)12-19-11-13-9-6-5-7-10-13/h1,5-7,9-10,14-16,18H,8,11-12H2,2-3H3/t14-,15-,16-/m0/s1 |
| InChIKey | DGRPDRANYZELCK-JYJNAYRXSA-N |
| XLogP | 2.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|