C21H28O5 — CID 11451246
[(2S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-4-en-2-yl] prop-2-enoate (PubChem CID 11451246) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(2S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-4-en-2-yl] prop-2-enoate.
| Compound Name | [(2S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-4-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11451246 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(2S)-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-4-en-2-yl] prop-2-enoate |
| SMILES | C=CC[C@@H](C[C@@H]1OC(C)(C)O[C@H]1COCc1ccccc1)OC(=O)C=C |
| InChI | InChI=1S/C21H28O5/c1-5-10-17(24-20(22)6-2)13-18-19(26-21(3,4)25-18)15-23-14-16-11-8-7-9-12-16/h5-9,11-12,17-19H,1-2,10,13-15H2,3-4H3/t17-,18-,19-/m0/s1 |
| InChIKey | RFTQDJCLQHQGIT-FHWLQOOXSA-N |
| XLogP | 3.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|