C46H56O9 — CID 25139297
(1R)-1-[(4S,5R)-2,2-dimethyl-5-[(E)-pent-1-enyl]-1,3-dioxolan-4-yl]-2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanol (PubChem CID 25139297) has the molecular formula C46H56O9 and a molecular weight of 752.95 g/mol. Its IUPAC name is (1R)-1-[(4S,5R)-2,2-dimethyl-5-[(E)-pent-1-enyl]-1,3-dioxolan-4-yl]-2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanol.
| Compound Name | (1R)-1-[(4S,5R)-2,2-dimethyl-5-[(E)-pent-1-enyl]-1,3-dioxolan-4-yl]-2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanol |
|---|---|
| PubChem CID | 25139297 |
| Molecular Formula | C46H56O9 |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.39 |
| IUPAC Name | (1R)-1-[(4S,5R)-2,2-dimethyl-5-[(E)-pent-1-enyl]-1,3-dioxolan-4-yl]-2-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanol |
| SMILES | CCC/C=C/[C@H]1OC(C)(C)O[C@H]1[C@H](O)CO[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H56O9/c1-4-5-10-27-39-41(55-46(2,3)54-39)38(47)32-52-45-44(51-31-37-25-17-9-18-26-37)43(50-30-36-23-15-8-16-24-36)42(49-29-35-21-13-7-14-22-35)40(53-45)33-48-28-34-19-11-6-12-20-34/h6-27,38-45,47H,4-5,28-33H2,1-3H3/b27-10+/t38-,39-,40-,41+,42+,43+,44-,45+/m1/s1 |
| InChIKey | JQEBGSIEOMAFEK-AYQZQFMASA-N |
| XLogP | 7.94 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|