C43H51NO9 — CID 149081212
[(4R,5S)-2,2-dimethyl-5-[(1S)-1-(methylideneamino)-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 149081212) has the molecular formula C43H51NO9 and a molecular weight of 725.88 g/mol. Its IUPAC name is [(4R,5S)-2,2-dimethyl-5-[(1S)-1-(methylideneamino)-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-2,2-dimethyl-5-[(1S)-1-(methylideneamino)-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 149081212 |
| Molecular Formula | C43H51NO9 |
| Molecular Weight | 725.88 g/mol |
| Exact Mass | 725.36 |
| IUPAC Name | [(4R,5S)-2,2-dimethyl-5-[(1S)-1-(methylideneamino)-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | C=N[C@@H](COC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1)[C@@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C43H51NO9/c1-43(2)52-36(24-45)38(53-43)35(44-3)29-50-42-41(49-28-34-22-14-7-15-23-34)40(48-27-33-20-12-6-13-21-33)39(47-26-32-18-10-5-11-19-32)37(51-42)30-46-25-31-16-8-4-9-17-31/h4-23,35-42,45H,3,24-30H2,1-2H3/t35-,36+,37?,38-,39?,40?,41?,42?/m0/s1 |
| InChIKey | QQJASTXIDUHNCB-TVOAJWPQSA-N |
| XLogP | 6.28 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.88 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|