C49H61NO8 — CID 134389571
1-[(1S)-1-[(4S,5R)-5-(cyclopentylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]aziridine (PubChem CID 134389571) has the molecular formula C49H61NO8 and a molecular weight of 792.03 g/mol. Its IUPAC name is 1-[(1S)-1-[(4S,5R)-5-(cyclopentylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]aziridine.
| Compound Name | 1-[(1S)-1-[(4S,5R)-5-(cyclopentylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]aziridine |
|---|---|
| PubChem CID | 134389571 |
| Molecular Formula | C49H61NO8 |
| Molecular Weight | 792.03 g/mol |
| Exact Mass | 791.44 |
| IUPAC Name | 1-[(1S)-1-[(4S,5R)-5-(cyclopentylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethyl]aziridine |
| SMILES | CC1(C)O[C@@H]([C@H](COC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)N2CC2)[C@@H](CC2CCCC2)O1 |
| InChI | InChI=1S/C49H61NO8/c1-49(2)57-42(29-36-17-15-16-18-36)44(58-49)41(50-27-28-50)34-55-48-47(54-33-40-25-13-6-14-26-40)46(53-32-39-23-11-5-12-24-39)45(52-31-38-21-9-4-10-22-38)43(56-48)35-51-30-37-19-7-3-8-20-37/h3-14,19-26,36,41-48H,15-18,27-35H2,1-2H3/t41-,42+,43?,44-,45?,46?,47?,48?/m0/s1 |
| InChIKey | HJMCCWAGZJJBPO-OXGKUMIQSA-N |
| XLogP | 8.49 |
| TPSA | 76.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.03 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|