C42H50O8 — CID 134389486
3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[2-[(5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethoxy]oxane (PubChem CID 134389486) has the molecular formula C42H50O8 and a molecular weight of 682.85 g/mol. Its IUPAC name is 3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[2-[(5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethoxy]oxane.
| Compound Name | 3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[2-[(5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethoxy]oxane |
|---|---|
| PubChem CID | 134389486 |
| Molecular Formula | C42H50O8 |
| Molecular Weight | 682.85 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[2-[(5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethoxy]oxane |
| SMILES | C[C@H]1OC(C)(C)OC1CCOC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C42H50O8/c1-31-36(50-42(2,3)49-31)24-25-44-41-40(47-29-35-22-14-7-15-23-35)39(46-28-34-20-12-6-13-21-34)38(45-27-33-18-10-5-11-19-33)37(48-41)30-43-26-32-16-8-4-9-17-32/h4-23,31,36-41H,24-30H2,1-3H3/t31-,36?,37?,38?,39?,40?,41?/m1/s1 |
| InChIKey | DUVOLVMIGFTBKW-UUJIZYTKSA-N |
| XLogP | 7.63 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.85 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |